C16H19Cl2N3O2 — CID 39033208
2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 39033208) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 39033208 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cc1c(C)nn(-c2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C16H19Cl2N3O2/c1-10-13(9-16(22)19-6-7-23-3)11(2)21(20-10)12-4-5-14(17)15(18)8-12/h4-5,8H,6-7,9H2,1-3H3,(H,19,22) |
| InChIKey | FGQTWGDADQTUSS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|