C20H22Cl2N4O3 — CID 56559323
2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]acetamide (PubChem CID 56559323) has the molecular formula C20H22Cl2N4O3 and a molecular weight of 437.33 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]acetamide.
| Compound Name | 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 56559323 |
| Molecular Formula | C20H22Cl2N4O3 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]acetamide |
| SMILES | Cc1nn(-c2ccc(Cl)c(Cl)c2)c(C)c1CC(=O)NCCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C20H22Cl2N4O3/c1-12-15(13(2)26(24-12)14-4-5-16(21)17(22)10-14)11-18(27)23-8-3-9-25-19(28)6-7-20(25)29/h4-5,10H,3,6-9,11H2,1-2H3,(H,23,27) |
| InChIKey | AFVNEXCNGIOGRG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|