C16H21ClN4O — CID 119407249
N-(3-aminopropyl)-2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetamide (PubChem CID 119407249) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetamide.
| Compound Name | N-(3-aminopropyl)-2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 119407249 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-(3-aminopropyl)-2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetamide |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c(C)c1CC(=O)NCCCN |
| InChI | InChI=1S/C16H21ClN4O/c1-11-15(10-16(22)19-9-3-8-18)12(2)21(20-11)14-6-4-13(17)5-7-14/h4-7H,3,8-10,18H2,1-2H3,(H,19,22) |
| InChIKey | LNSIZUOZSWYOAO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|