C21H22ClN5O2 — CID 55765954
N-[2-[[2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 55765954) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is N-[2-[[2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55765954 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[2-[[2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c(C)c1CC(=O)NCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C21H22ClN5O2/c1-14-19(15(2)27(26-14)18-7-5-17(22)6-8-18)12-20(28)24-10-11-25-21(29)16-4-3-9-23-13-16/h3-9,13H,10-12H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | QUSIMBAWLHDHLA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|