C17H20ClN3O3S — CID 119241593
2-[2-[[2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241593) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is 2-[2-[[2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241593 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-[2-[[2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c(C)c1CC(=O)NCCSCC(=O)O |
| InChI | InChI=1S/C17H20ClN3O3S/c1-11-15(9-16(22)19-7-8-25-10-17(23)24)12(2)21(20-11)14-5-3-13(18)4-6-14/h3-6H,7-10H2,1-2H3,(H,19,22)(H,23,24) |
| InChIKey | PHFMTAWPLHNXAY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|