C19H21N7O3S2 — CID 24553661
N'-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 24553661) has the molecular formula C19H21N7O3S2 and a molecular weight of 459.56 g/mol. Its IUPAC name is N'-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24553661 |
| Molecular Formula | C19H21N7O3S2 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | N'-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)NNC(=O)c2csc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C19H21N7O3S2/c1-12-2-4-13(5-3-12)16-22-24-18(30)26(16)10-15(27)21-23-17(28)14-11-31-19(20-14)25-6-8-29-9-7-25/h2-5,11H,6-10H2,1H3,(H,21,27)(H,23,28)(H,24,30) |
| InChIKey | VMNNGTVELNNVBE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|