C20H28N6O5S — CID 55454915
N'-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 55454915) has the molecular formula C20H28N6O5S and a molecular weight of 464.55 g/mol. Its IUPAC name is N'-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55454915 |
| Molecular Formula | C20H28N6O5S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N'-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)NNC(=O)c1csc(N3CCOCC3)n1)C2=O |
| InChI | InChI=1S/C20H28N6O5S/c1-2-13-3-5-20(6-4-13)17(29)26(18(30)22-20)11-15(27)23-24-16(28)14-12-32-19(21-14)25-7-9-31-10-8-25/h12-13H,2-11H2,1H3,(H,22,30)(H,23,27)(H,24,28) |
| InChIKey | SAJQFJYBLCKAFY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|