C23H32N4O6 — CID 55344117
2-(4-ethoxyphenoxy)-N'-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]propanehydrazide (PubChem CID 55344117) has the molecular formula C23H32N4O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N'-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]propanehydrazide.
| Compound Name | 2-(4-ethoxyphenoxy)-N'-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 55344117 |
| Molecular Formula | C23H32N4O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N'-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]propanehydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)CN2C(=O)NC3(CCC(CC)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H32N4O6/c1-4-16-10-12-23(13-11-16)21(30)27(22(31)24-23)14-19(28)25-26-20(29)15(3)33-18-8-6-17(7-9-18)32-5-2/h6-9,15-16H,4-5,10-14H2,1-3H3,(H,24,31)(H,25,28)(H,26,29) |
| InChIKey | IIEZUYOIALQSDC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|