C22H29FN4O5 — CID 55347953
2-(4-fluorophenoxy)-N'-[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]propanehydrazide (PubChem CID 55347953) has the molecular formula C22H29FN4O5 and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N'-[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]propanehydrazide.
| Compound Name | 2-(4-fluorophenoxy)-N'-[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 55347953 |
| Molecular Formula | C22H29FN4O5 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-(4-fluorophenoxy)-N'-[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]propanehydrazide |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)NNC(=O)C(C)Oc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C22H29FN4O5/c1-13-9-21(3,4)12-22(10-13)19(30)27(20(31)24-22)11-17(28)25-26-18(29)14(2)32-16-7-5-15(23)6-8-16/h5-8,13-14H,9-12H2,1-4H3,(H,24,31)(H,25,28)(H,26,29) |
| InChIKey | OEZPAQUKGLCREN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|