C21H19N5O3S — CID 27685707
3-methyl-N'-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-1-benzofuran-2-carbohydrazide (PubChem CID 27685707) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-methyl-N'-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 3-methyl-N'-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 27685707 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 3-methyl-N'-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)NNC(=O)c2oc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C21H19N5O3S/c1-12-7-9-14(10-8-12)19-23-25-21(30)26(19)11-17(27)22-24-20(28)18-13(2)15-5-3-4-6-16(15)29-18/h3-10H,11H2,1-2H3,(H,22,27)(H,24,28)(H,25,30) |
| InChIKey | JARXGPNABICYAA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|