C21H18ClN7O3S — CID 27564261
N'-[2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 27564261) has the molecular formula C21H18ClN7O3S and a molecular weight of 483.94 g/mol. Its IUPAC name is N'-[2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-[2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 27564261 |
| Molecular Formula | C21H18ClN7O3S |
| Molecular Weight | 483.94 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | N'-[2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)Cn2c(-c3ccc(Cl)cc3)n[nH]c2=S)c2ccccc2c1=O |
| InChI | InChI=1S/C21H18ClN7O3S/c1-2-29-20(32)15-6-4-3-5-14(15)17(27-29)19(31)25-23-16(30)11-28-18(24-26-21(28)33)12-7-9-13(22)10-8-12/h3-10H,2,11H2,1H3,(H,23,30)(H,25,31)(H,26,33) |
| InChIKey | DKNYIBZKGPEMEK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.94 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|