C17H14ClN5O3S — CID 27698436
N'-[2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-2-hydroxybenzohydrazide (PubChem CID 27698436) has the molecular formula C17H14ClN5O3S and a molecular weight of 403.85 g/mol. Its IUPAC name is N'-[2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 27698436 |
| Molecular Formula | C17H14ClN5O3S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N'-[2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]-2-hydroxybenzohydrazide |
| SMILES | O=C(Cn1c(-c2ccc(Cl)cc2)n[nH]c1=S)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C17H14ClN5O3S/c18-11-7-5-10(6-8-11)15-20-22-17(27)23(15)9-14(25)19-21-16(26)12-3-1-2-4-13(12)24/h1-8,24H,9H2,(H,19,25)(H,21,26)(H,22,27) |
| InChIKey | PQTPVDYDVNUMRP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|