C14H15ClN4OS — CID 27670434
2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 27670434) has the molecular formula C14H15ClN4OS and a molecular weight of 322.82 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 27670434 |
| Molecular Formula | C14H15ClN4OS |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(Cn1c(-c2ccc(Cl)cc2)n[nH]c1=S)N1CCCC1 |
| InChI | InChI=1S/C14H15ClN4OS/c15-11-5-3-10(4-6-11)13-16-17-14(21)19(13)9-12(20)18-7-1-2-8-18/h3-6H,1-2,7-9H2,(H,17,21) |
| InChIKey | CIXZJFNZYJTRFK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|