C21H20ClN5O2S — CID 24545123
1-(4-benzoylpiperazin-1-yl)-2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]ethanone (PubChem CID 24545123) has the molecular formula C21H20ClN5O2S and a molecular weight of 441.94 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]ethanone.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]ethanone |
|---|---|
| PubChem CID | 24545123 |
| Molecular Formula | C21H20ClN5O2S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]ethanone |
| SMILES | O=C(Cn1c(-c2ccc(Cl)cc2)n[nH]c1=S)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H20ClN5O2S/c22-17-8-6-15(7-9-17)19-23-24-21(30)27(19)14-18(28)25-10-12-26(13-11-25)20(29)16-4-2-1-3-5-16/h1-9H,10-14H2,(H,24,30) |
| InChIKey | PFUWMHJYIAUEDD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|