C20H20ClN5O3S — CID 38199247
2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-(furan-3-carbonyl)piperidin-4-yl]acetamide (PubChem CID 38199247) has the molecular formula C20H20ClN5O3S and a molecular weight of 445.93 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-(furan-3-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-(furan-3-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 38199247 |
| Molecular Formula | C20H20ClN5O3S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-(furan-3-carbonyl)piperidin-4-yl]acetamide |
| SMILES | O=C(Cn1c(-c2ccc(Cl)cc2)n[nH]c1=S)NC1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C20H20ClN5O3S/c21-15-3-1-13(2-4-15)18-23-24-20(30)26(18)11-17(27)22-16-5-8-25(9-6-16)19(28)14-7-10-29-12-14/h1-4,7,10,12,16H,5-6,8-9,11H2,(H,22,27)(H,24,30) |
| InChIKey | NZCXURGTHJARCH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|