C21H30N6O2S — CID 18227274
N-butyl-2-[4-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]piperazin-1-yl]acetamide (PubChem CID 18227274) has the molecular formula C21H30N6O2S and a molecular weight of 430.58 g/mol. Its IUPAC name is N-butyl-2-[4-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 18227274 |
| Molecular Formula | C21H30N6O2S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | N-butyl-2-[4-[2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetyl]piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)Cn2c(-c3ccc(C)cc3)n[nH]c2=S)CC1 |
| InChI | InChI=1S/C21H30N6O2S/c1-3-4-9-22-18(28)14-25-10-12-26(13-11-25)19(29)15-27-20(23-24-21(27)30)17-7-5-16(2)6-8-17/h5-8H,3-4,9-15H2,1-2H3,(H,22,28)(H,24,30) |
| InChIKey | FULBDHGKUMJZJE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|