C18H26N6O2S2 — CID 18272547
N-butyl-2-[4-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]piperazin-1-yl]acetamide (PubChem CID 18272547) has the molecular formula C18H26N6O2S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-butyl-2-[4-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 18272547 |
| Molecular Formula | C18H26N6O2S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-butyl-2-[4-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)Cn2c(-c3cccs3)n[nH]c2=S)CC1 |
| InChI | InChI=1S/C18H26N6O2S2/c1-2-3-6-19-15(25)12-22-7-9-23(10-8-22)16(26)13-24-17(20-21-18(24)27)14-5-4-11-28-14/h4-5,11H,2-3,6-10,12-13H2,1H3,(H,19,25)(H,21,27) |
| InChIKey | QYXAQLQLQADPSK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|