C18H18ClN5OS2 — CID 134044577
1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)ethanone (PubChem CID 134044577) has the molecular formula C18H18ClN5OS2 and a molecular weight of 419.96 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)ethanone.
| Compound Name | 1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)ethanone |
|---|---|
| PubChem CID | 134044577 |
| Molecular Formula | C18H18ClN5OS2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)ethanone |
| SMILES | O=C(Cn1c(-c2cccs2)n[nH]c1=S)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H18ClN5OS2/c19-13-4-1-2-5-14(13)22-7-9-23(10-8-22)16(25)12-24-17(20-21-18(24)26)15-6-3-11-27-15/h1-6,11H,7-10,12H2,(H,21,26) |
| InChIKey | VJBRUTQUMHXIBB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|