C15H18N4OS2 — CID 18165966
N-(3-ethylpent-1-yn-3-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 18165966) has the molecular formula C15H18N4OS2 and a molecular weight of 334.47 g/mol. Its IUPAC name is N-(3-ethylpent-1-yn-3-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(3-ethylpent-1-yn-3-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 18165966 |
| Molecular Formula | C15H18N4OS2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(3-ethylpent-1-yn-3-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)Cn1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C15H18N4OS2/c1-4-15(5-2,6-3)16-12(20)10-19-13(17-18-14(19)21)11-8-7-9-22-11/h1,7-9H,5-6,10H2,2-3H3,(H,16,20)(H,18,21) |
| InChIKey | IAGZINOSLCMOHW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|