C20H18N4OS2 — CID 46599170
N-(1-naphthalen-2-ylethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 46599170) has the molecular formula C20H18N4OS2 and a molecular weight of 394.53 g/mol. Its IUPAC name is N-(1-naphthalen-2-ylethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(1-naphthalen-2-ylethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 46599170 |
| Molecular Formula | C20H18N4OS2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-(1-naphthalen-2-ylethyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CC(NC(=O)Cn1c(-c2cccs2)n[nH]c1=S)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H18N4OS2/c1-13(15-9-8-14-5-2-3-6-16(14)11-15)21-18(25)12-24-19(22-23-20(24)26)17-7-4-10-27-17/h2-11,13H,12H2,1H3,(H,21,25)(H,23,26) |
| InChIKey | UHGBJIGVSJIHKH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|