C16H14F2N4OS2 — CID 46587972
N-[1-(2,5-difluorophenyl)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 46587972) has the molecular formula C16H14F2N4OS2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 46587972 |
| Molecular Formula | C16H14F2N4OS2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CC(NC(=O)Cn1c(-c2cccs2)n[nH]c1=S)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H14F2N4OS2/c1-9(11-7-10(17)4-5-12(11)18)19-14(23)8-22-15(20-21-16(22)24)13-3-2-6-25-13/h2-7,9H,8H2,1H3,(H,19,23)(H,21,24) |
| InChIKey | IBFOZOSEVDEIPU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|