C14H13N5OS3 — CID 32867306
N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 32867306) has the molecular formula C14H13N5OS3 and a molecular weight of 363.49 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 32867306 |
| Molecular Formula | C14H13N5OS3 |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | O=C(Cn1c(-c2cccs2)n[nH]c1=S)Nc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C14H13N5OS3/c20-11(16-13-15-9(7-23-13)8-3-4-8)6-19-12(17-18-14(19)21)10-2-1-5-22-10/h1-2,5,7-8H,3-4,6H2,(H,18,21)(H,15,16,20) |
| InChIKey | SNWFDAKFFYLPOV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|