C13H9F2N3S2 — CID 63794475
4-[(2,5-difluorophenyl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 63794475) has the molecular formula C13H9F2N3S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-[(2,5-difluorophenyl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2,5-difluorophenyl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 63794475 |
| Molecular Formula | C13H9F2N3S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 4-[(2,5-difluorophenyl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1ccc(F)c(Cn2c(-c3cccs3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C13H9F2N3S2/c14-9-3-4-10(15)8(6-9)7-18-12(16-17-13(18)19)11-2-1-5-20-11/h1-6H,7H2,(H,17,19) |
| InChIKey | JNXUFLUNKFBGEQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|