C17H17FN4O2S2 — CID 46433235
N-[2-(3-fluorophenoxy)ethyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 46433235) has the molecular formula C17H17FN4O2S2 and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 46433235 |
| Molecular Formula | C17H17FN4O2S2 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | O=C(CCn1c(-c2cccs2)n[nH]c1=S)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C17H17FN4O2S2/c18-12-3-1-4-13(11-12)24-9-7-19-15(23)6-8-22-16(20-21-17(22)25)14-5-2-10-26-14/h1-5,10-11H,6-9H2,(H,19,23)(H,21,25) |
| InChIKey | MBQHEFZHVXVPNL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|