C17H18N4O2S2 — CID 27859340
N-[2-(3-methylphenoxy)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 27859340) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[2-(3-methylphenoxy)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[2-(3-methylphenoxy)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 27859340 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-[2-(3-methylphenoxy)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | Cc1cccc(OCCNC(=O)Cn2c(-c3cccs3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C17H18N4O2S2/c1-12-4-2-5-13(10-12)23-8-7-18-15(22)11-21-16(19-20-17(21)24)14-6-3-9-25-14/h2-6,9-10H,7-8,11H2,1H3,(H,18,22)(H,20,24) |
| InChIKey | DXOLIEFRZSHSPG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|