C18H16N6OS2 — CID 60551455
2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)acetamide (PubChem CID 60551455) has the molecular formula C18H16N6OS2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)acetamide.
| Compound Name | 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 60551455 |
| Molecular Formula | C18H16N6OS2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(5-thiophen-2-yl-1H-pyrazol-3-yl)acetamide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CC(=O)Nc2cc(-c3cccs3)[nH]n2)c1 |
| InChI | InChI=1S/C18H16N6OS2/c1-11-4-2-5-12(8-11)17-22-23-18(26)24(17)10-16(25)19-15-9-13(20-21-15)14-6-3-7-27-14/h2-9H,10H2,1H3,(H,23,26)(H2,19,20,21,25) |
| InChIKey | KVBUYMSSCUPESA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|