C17H17N5O3S2 — CID 24553899
2-(4-methoxyphenyl)-N'-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]acetohydrazide (PubChem CID 24553899) has the molecular formula C17H17N5O3S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N'-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]acetohydrazide.
| Compound Name | 2-(4-methoxyphenyl)-N'-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 24553899 |
| Molecular Formula | C17H17N5O3S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-N'-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetyl]acetohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(=O)Cn2c(-c3cccs3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H17N5O3S2/c1-25-12-6-4-11(5-7-12)9-14(23)18-19-15(24)10-22-16(20-21-17(22)26)13-3-2-8-27-13/h2-8H,9-10H2,1H3,(H,18,23)(H,19,24)(H,21,26) |
| InChIKey | JLUNZYBQUJBSMH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|