C21H18N4O2S2 — CID 38507615
N-[2-(4-methylphenoxy)phenyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 38507615) has the molecular formula C21H18N4O2S2 and a molecular weight of 422.54 g/mol. Its IUPAC name is N-[2-(4-methylphenoxy)phenyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[2-(4-methylphenoxy)phenyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 38507615 |
| Molecular Formula | C21H18N4O2S2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[2-(4-methylphenoxy)phenyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | Cc1ccc(Oc2ccccc2NC(=O)Cn2c(-c3cccs3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C21H18N4O2S2/c1-14-8-10-15(11-9-14)27-17-6-3-2-5-16(17)22-19(26)13-25-20(23-24-21(25)28)18-7-4-12-29-18/h2-12H,13H2,1H3,(H,22,26)(H,24,28) |
| InChIKey | ZGSVIOMVTBBYSF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|