C18H26N4O2S2 — CID 18121181
N-(3-cyclohexyloxypropyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 18121181) has the molecular formula C18H26N4O2S2 and a molecular weight of 394.57 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 18121181 |
| Molecular Formula | C18H26N4O2S2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | O=C(CCn1c(-c2cccs2)n[nH]c1=S)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C18H26N4O2S2/c23-16(19-10-5-12-24-14-6-2-1-3-7-14)9-11-22-17(20-21-18(22)25)15-8-4-13-26-15/h4,8,13-14H,1-3,5-7,9-12H2,(H,19,23)(H,21,25) |
| InChIKey | HRXTUUYWKCKPGR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|