C17H20N4OS2 — CID 102559733
3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide (PubChem CID 102559733) has the molecular formula C17H20N4OS2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide.
| Compound Name | 3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide |
|---|---|
| PubChem CID | 102559733 |
| Molecular Formula | C17H20N4OS2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide |
| SMILES | O=C(CCn1c(-c2cccs2)n[nH]c1=S)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C17H20N4OS2/c22-12(18-15-13-9-3-4-10(8-9)14(13)15)5-6-21-16(19-20-17(21)23)11-2-1-7-24-11/h1-2,7,9-10,13-15H,3-6,8H2,(H,18,22)(H,20,23) |
| InChIKey | RQSVBZJXZBVNDJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|