C15H20N4O2S2 — CID 99716987
N-[(1S,2R)-2-methoxycyclopentyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 99716987) has the molecular formula C15H20N4O2S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is N-[(1S,2R)-2-methoxycyclopentyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-[(1S,2R)-2-methoxycyclopentyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 99716987 |
| Molecular Formula | C15H20N4O2S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[(1S,2R)-2-methoxycyclopentyl]-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | CO[C@@H]1CCC[C@@H]1NC(=O)CCn1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C15H20N4O2S2/c1-21-11-5-2-4-10(11)16-13(20)7-8-19-14(17-18-15(19)22)12-6-3-9-23-12/h3,6,9-11H,2,4-5,7-8H2,1H3,(H,16,20)(H,18,22)/t10-,11+/m0/s1 |
| InChIKey | QFLUOQVLRHDSTE-WDEREUQCSA-N |
| XLogP | 2.74 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|