C14H17N5S2 — CID 114537939
4-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 114537939) has the molecular formula C14H17N5S2 and a molecular weight of 319.46 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 114537939 |
| Molecular Formula | C14H17N5S2 |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 4-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(C)n(CCCn2c(-c3cccs3)n[nH]c2=S)n1 |
| InChI | InChI=1S/C14H17N5S2/c1-10-9-11(2)19(17-10)7-4-6-18-13(15-16-14(18)20)12-5-3-8-21-12/h3,5,8-9H,4,6-7H2,1-2H3,(H,16,20) |
| InChIKey | FKXJRBBBDFKEQD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|