C10H9N5OS2 — CID 114184691
4-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 114184691) has the molecular formula C10H9N5OS2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 4-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 114184691 |
| Molecular Formula | C10H9N5OS2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 4-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cccs2)n1CCc1ncno1 |
| InChI | InChI=1S/C10H9N5OS2/c17-10-14-13-9(7-2-1-5-18-7)15(10)4-3-8-11-6-12-16-8/h1-2,5-6H,3-4H2,(H,14,17) |
| InChIKey | QASMVUCBHZJRII-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|