C11H14N4OS2 — CID 106276410
2,2-dimethyl-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 106276410) has the molecular formula C11H14N4OS2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2,2-dimethyl-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | 2,2-dimethyl-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 106276410 |
| Molecular Formula | C11H14N4OS2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2,2-dimethyl-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | CC(C)(Cn1c(-c2cccs2)n[nH]c1=S)C(N)=O |
| InChI | InChI=1S/C11H14N4OS2/c1-11(2,9(12)16)6-15-8(13-14-10(15)17)7-4-3-5-18-7/h3-5H,6H2,1-2H3,(H2,12,16)(H,14,17) |
| InChIKey | NABMWEZFRUPECF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|