C11H15N3O2S3 — CID 79561512
4-(2-methyl-2-methylsulfonylpropyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 79561512) has the molecular formula C11H15N3O2S3 and a molecular weight of 317.46 g/mol. Its IUPAC name is 4-(2-methyl-2-methylsulfonylpropyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methyl-2-methylsulfonylpropyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 79561512 |
| Molecular Formula | C11H15N3O2S3 |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 4-(2-methyl-2-methylsulfonylpropyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(Cn1c(-c2cccs2)n[nH]c1=S)S(C)(=O)=O |
| InChI | InChI=1S/C11H15N3O2S3/c1-11(2,19(3,15)16)7-14-9(12-13-10(14)17)8-5-4-6-18-8/h4-6H,7H2,1-3H3,(H,13,17) |
| InChIKey | LHVHQPWFRKZXNU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|