C14H19N3S2 — CID 106005770
4-(3-cyclopentylpropyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 106005770) has the molecular formula C14H19N3S2 and a molecular weight of 293.46 g/mol. Its IUPAC name is 4-(3-cyclopentylpropyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(3-cyclopentylpropyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106005770 |
| Molecular Formula | C14H19N3S2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-(3-cyclopentylpropyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cccs2)n1CCCC1CCCC1 |
| InChI | InChI=1S/C14H19N3S2/c18-14-16-15-13(12-8-4-10-19-12)17(14)9-3-7-11-5-1-2-6-11/h4,8,10-11H,1-3,5-7,9H2,(H,16,18) |
| InChIKey | HRBXNENYYXNPAI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|