C17H18N4OS3 — CID 31330622
N-prop-2-enyl-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 31330622) has the molecular formula C17H18N4OS3 and a molecular weight of 390.56 g/mol. Its IUPAC name is N-prop-2-enyl-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | N-prop-2-enyl-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 31330622 |
| Molecular Formula | C17H18N4OS3 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-prop-2-enyl-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)CCn1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C17H18N4OS3/c1-2-8-20(12-13-5-3-10-24-13)15(22)7-9-21-16(18-19-17(21)23)14-6-4-11-25-14/h2-6,10-11H,1,7-9,12H2,(H,19,23) |
| InChIKey | FEBWIGUUUIHUHK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|