C17H17ClN4OS3 — CID 52908661
(2R)-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 52908661) has the molecular formula C17H17ClN4OS3 and a molecular weight of 425.00 g/mol. Its IUPAC name is (2R)-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | (2R)-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 52908661 |
| Molecular Formula | C17H17ClN4OS3 |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | (2R)-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)[C@@H](C)n1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C17H17ClN4OS3/c1-3-8-21(10-12-6-7-14(18)26-12)16(23)11(2)22-15(19-20-17(22)24)13-5-4-9-25-13/h3-7,9,11H,1,8,10H2,2H3,(H,20,24)/t11-/m1/s1 |
| InChIKey | BFBPMNVHTXQRTE-LLVKDONJSA-N |
| XLogP | 5.16 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|