C9H8N3O2S2- — CID 7129288
(2S)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoate (PubChem CID 7129288) has the molecular formula C9H8N3O2S2- and a molecular weight of 254.32 g/mol. Its IUPAC name is (2S)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoate.
| Compound Name | (2S)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoate |
|---|---|
| PubChem CID | 7129288 |
| Molecular Formula | C9H8N3O2S2- |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | (2S)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoate |
| SMILES | C[C@@H](C(=O)[O-])n1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C9H9N3O2S2/c1-5(8(13)14)12-7(10-11-9(12)15)6-3-2-4-16-6/h2-5H,1H3,(H,11,15)(H,13,14)/p-1/t5-/m0/s1 |
| InChIKey | MTCPVWYULUALKM-YFKPBYRVSA-M |
| XLogP | 0.98 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|