C15H13ClN4OS2 — CID 95049742
(2S)-N-(4-chlorophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 95049742) has the molecular formula C15H13ClN4OS2 and a molecular weight of 364.88 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 95049742 |
| Molecular Formula | C15H13ClN4OS2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cc1)n1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C15H13ClN4OS2/c1-9(14(21)17-11-6-4-10(16)5-7-11)20-13(18-19-15(20)22)12-3-2-8-23-12/h2-9H,1H3,(H,17,21)(H,19,22)/t9-/m0/s1 |
| InChIKey | GRLMIRWUZGPILZ-VIFPVBQESA-N |
| XLogP | 4.52 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|