C19H17N7O2S2 — CID 56509673
1-[4-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoylamino]phenyl]pyrazole-3-carboxamide (PubChem CID 56509673) has the molecular formula C19H17N7O2S2 and a molecular weight of 439.53 g/mol. Its IUPAC name is 1-[4-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoylamino]phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[4-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoylamino]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56509673 |
| Molecular Formula | C19H17N7O2S2 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 1-[4-[2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoylamino]phenyl]pyrazole-3-carboxamide |
| SMILES | CC(C(=O)Nc1ccc(-n2ccc(C(N)=O)n2)cc1)n1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C19H17N7O2S2/c1-11(26-17(22-23-19(26)29)15-3-2-10-30-15)18(28)21-12-4-6-13(7-5-12)25-9-8-14(24-25)16(20)27/h2-11H,1H3,(H2,20,27)(H,21,28)(H,23,29) |
| InChIKey | WNPFWHLPHWZLLQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|