C16H22N4OS2 — CID 71881549
N-cycloheptyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 71881549) has the molecular formula C16H22N4OS2 and a molecular weight of 350.51 g/mol. Its IUPAC name is N-cycloheptyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-cycloheptyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 71881549 |
| Molecular Formula | C16H22N4OS2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-cycloheptyl-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | CC(C(=O)NC1CCCCCC1)n1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C16H22N4OS2/c1-11(15(21)17-12-7-4-2-3-5-8-12)20-14(18-19-16(20)22)13-9-6-10-23-13/h6,9-12H,2-5,7-8H2,1H3,(H,17,21)(H,19,22) |
| InChIKey | RTBUVABKWFSGEP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|