C16H15FN4OS2 — CID 95049773
(2R)-N-(5-fluoro-2-methylphenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 95049773) has the molecular formula C16H15FN4OS2 and a molecular weight of 362.46 g/mol. Its IUPAC name is (2R)-N-(5-fluoro-2-methylphenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | (2R)-N-(5-fluoro-2-methylphenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 95049773 |
| Molecular Formula | C16H15FN4OS2 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (2R)-N-(5-fluoro-2-methylphenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | Cc1ccc(F)cc1NC(=O)[C@@H](C)n1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C16H15FN4OS2/c1-9-5-6-11(17)8-12(9)18-15(22)10(2)21-14(19-20-16(21)23)13-4-3-7-24-13/h3-8,10H,1-2H3,(H,18,22)(H,20,23)/t10-/m1/s1 |
| InChIKey | ANGJKWCTVTXQFO-SNVBAGLBSA-N |
| XLogP | 4.32 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|