C15H12Cl2N4OS2 — CID 52536632
(2S)-N-(3,4-dichlorophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 52536632) has the molecular formula C15H12Cl2N4OS2 and a molecular weight of 399.33 g/mol. Its IUPAC name is (2S)-N-(3,4-dichlorophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | (2S)-N-(3,4-dichlorophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 52536632 |
| Molecular Formula | C15H12Cl2N4OS2 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | (2S)-N-(3,4-dichlorophenyl)-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)c(Cl)c1)n1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C15H12Cl2N4OS2/c1-8(14(22)18-9-4-5-10(16)11(17)7-9)21-13(19-20-15(21)23)12-3-2-6-24-12/h2-8H,1H3,(H,18,22)(H,20,23)/t8-/m0/s1 |
| InChIKey | ISXDRHNQJUGOTH-QMMMGPOBSA-N |
| XLogP | 5.18 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|