C14H20N4OS2 — CID 97210964
(2R)-N-[(2R)-pentan-2-yl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 97210964) has the molecular formula C14H20N4OS2 and a molecular weight of 324.48 g/mol. Its IUPAC name is (2R)-N-[(2R)-pentan-2-yl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | (2R)-N-[(2R)-pentan-2-yl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 97210964 |
| Molecular Formula | C14H20N4OS2 |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2R)-N-[(2R)-pentan-2-yl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | CCC[C@@H](C)NC(=O)[C@@H](C)n1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C14H20N4OS2/c1-4-6-9(2)15-13(19)10(3)18-12(16-17-14(18)20)11-7-5-8-21-11/h5,7-10H,4,6H2,1-3H3,(H,15,19)(H,17,20)/t9-,10-/m1/s1 |
| InChIKey | OVRAQZJKOKFCDK-NXEZZACHSA-N |
| XLogP | 3.53 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|