C11H16Cl2N2OS — CID 119270779
(2R)-2-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enylpropanamide;hydrochloride (PubChem CID 119270779) has the molecular formula C11H16Cl2N2OS and a molecular weight of 295.24 g/mol. Its IUPAC name is (2R)-2-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enylpropanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119270779 |
| Molecular Formula | C11H16Cl2N2OS |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (2R)-2-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enylpropanamide;hydrochloride |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)[C@@H](C)N.Cl |
| InChI | InChI=1S/C11H15ClN2OS.ClH/c1-3-6-14(11(15)8(2)13)7-9-4-5-10(12)16-9;/h3-5,8H,1,6-7,13H2,2H3;1H/t8-;/m1./s1 |
| InChIKey | IUFSTBSHWTXDIY-DDWIOCJRSA-N |
| XLogP | 2.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|