C12H7ClIN3S2 — CID 107636709
4-(4-chloro-2-iodophenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 107636709) has the molecular formula C12H7ClIN3S2 and a molecular weight of 419.70 g/mol. Its IUPAC name is 4-(4-chloro-2-iodophenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-chloro-2-iodophenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 107636709 |
| Molecular Formula | C12H7ClIN3S2 |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 418.88 |
| IUPAC Name | 4-(4-chloro-2-iodophenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cccs2)n1-c1ccc(Cl)cc1I |
| InChI | InChI=1S/C12H7ClIN3S2/c13-7-3-4-9(8(14)6-7)17-11(15-16-12(17)18)10-2-1-5-19-10/h1-6H,(H,16,18) |
| InChIKey | HNMVMJLDTPHMFX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|