C13H9Cl2N3S2 — CID 104727484
4-(2,5-dichloro-4-methylphenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 104727484) has the molecular formula C13H9Cl2N3S2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 4-(2,5-dichloro-4-methylphenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,5-dichloro-4-methylphenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 104727484 |
| Molecular Formula | C13H9Cl2N3S2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | 4-(2,5-dichloro-4-methylphenyl)-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(Cl)c(-n2c(-c3cccs3)n[nH]c2=S)cc1Cl |
| InChI | InChI=1S/C13H9Cl2N3S2/c1-7-5-9(15)10(6-8(7)14)18-12(16-17-13(18)19)11-3-2-4-20-11/h2-6H,1H3,(H,17,19) |
| InChIKey | LYPONLKPAQAJEH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|