C13H8Cl2N4S2 — CID 3818318
4-[(2,6-dichlorophenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 3818318) has the molecular formula C13H8Cl2N4S2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2,6-dichlorophenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3818318 |
| Molecular Formula | C13H8Cl2N4S2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cccs2)n1N=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H8Cl2N4S2/c14-9-3-1-4-10(15)8(9)7-16-19-12(17-18-13(19)20)11-5-2-6-21-11/h1-7H,(H,18,20) |
| InChIKey | GDCJVBSWVGVRKR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|