C15H14N4O2S2 — CID 35653486
4-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 35653486) has the molecular formula C15H14N4O2S2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 4-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 35653486 |
| Molecular Formula | C15H14N4O2S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 4-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cccc(/C=N\n2c(-c3cccs3)n[nH]c2=S)c1OC |
| InChI | InChI=1S/C15H14N4O2S2/c1-20-11-6-3-5-10(13(11)21-2)9-16-19-14(17-18-15(19)22)12-7-4-8-23-12/h3-9H,1-2H3,(H,18,22)/b16-9- |
| InChIKey | IQGJZFRPMVQGSB-SXGWCWSVSA-N |
| XLogP | 3.57 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|